C21H19Cl2F3O5 — CID 141447245
methyl (2S,3S,4R)-4-(3,4-dichlorophenyl)-2-hydroxy-7,7-dimethyl-5-(oxomethylidene)-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate (PubChem CID 141447245) has the molecular formula C21H19Cl2F3O5 and a molecular weight of 479.28 g/mol. Its IUPAC name is methyl (2S,3S,4R)-4-(3,4-dichlorophenyl)-2-hydroxy-7,7-dimethyl-5-(oxomethylidene)-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate.
| Compound Name | methyl (2S,3S,4R)-4-(3,4-dichlorophenyl)-2-hydroxy-7,7-dimethyl-5-(oxomethylidene)-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 141447245 |
| Molecular Formula | C21H19Cl2F3O5 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | methyl (2S,3S,4R)-4-(3,4-dichlorophenyl)-2-hydroxy-7,7-dimethyl-5-(oxomethylidene)-2-(trifluoromethyl)-3,4,6,8-tetrahydrochromene-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccc(Cl)c(Cl)c2)C2=C(CC(C)(C)CC2=C=O)O[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C21H19Cl2F3O5/c1-19(2)7-11(9-27)15-14(8-19)31-20(29,21(24,25)26)17(18(28)30-3)16(15)10-4-5-12(22)13(23)6-10/h4-6,16-17,29H,7-8H2,1-3H3/t16-,17-,20+/m1/s1 |
| InChIKey | ZCZGCQOOBQGVJW-HLIPFELVSA-N |
| XLogP | 4.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|