C10H8Cl2FNO — CID 141447851
1-(2,6-dichloro-3-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 141447851) has the molecular formula C10H8Cl2FNO and a molecular weight of 248.08 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(2,6-dichloro-3-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 141447851 |
| Molecular Formula | C10H8Cl2FNO |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 1-(2,6-dichloro-3-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(c2c(Cl)ccc(F)c2Cl)CC1 |
| InChI | InChI=1S/C10H8Cl2FNO/c11-5-1-2-6(13)8(12)7(5)10(3-4-10)9(14)15/h1-2H,3-4H2,(H2,14,15) |
| InChIKey | DMIAOAVMTVXRMZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|