C13H8BF5O2S — CID 141447881
[4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]phenyl]boronic acid (PubChem CID 141447881) has the molecular formula C13H8BF5O2S and a molecular weight of 334.07 g/mol. Its IUPAC name is [4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]phenyl]boronic acid.
| Compound Name | [4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 141447881 |
| Molecular Formula | C13H8BF5O2S |
| Molecular Weight | 334.07 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(SCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H8BF5O2S/c15-9-8(10(16)12(18)13(19)11(9)17)5-22-7-3-1-6(2-4-7)14(20)21/h1-4,20-21H,5H2 |
| InChIKey | QQWHXDMVFYIXCH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.07 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|