C13H22N4OSi — CID 141449114
6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine (PubChem CID 141449114) has the molecular formula C13H22N4OSi and a molecular weight of 278.43 g/mol. Its IUPAC name is 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine.
| Compound Name | 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 141449114 |
| Molecular Formula | C13H22N4OSi |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine |
| SMILES | Cc1ccc2c(N)nn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C13H22N4OSi/c1-10-5-6-11-12(14)16-17(13(11)15-10)9-18-7-8-19(2,3)4/h5-6H,7-9H2,1-4H3,(H2,14,16) |
| InChIKey | WEVJARQRNLGBBF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|