About 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine
6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine (PubChem CID 141449114) has the molecular formula C13H22N4OSi
and a molecular weight of 278.43 g/mol. Its IUPAC name is 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine |
| PubChem CID | 141449114 |
| Molecular Formula | C13H22N4OSi |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine |
| SMILES | Cc1ccc2c(N)nn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C13H22N4OSi/c1-10-5-6-11-12(14)16-17(13(11)15-10)9-18-7-8-19(2,3)4/h5-6H,7-9H2,1-4H3,(H2,14,16) |
| InChIKey | WEVJARQRNLGBBF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine?
The IUPAC name of 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine (CID 141449114) is 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine.
What is the SMILES notation for 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine?
The canonical SMILES for 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine is Cc1ccc2c(N)nn(COCC[Si](C)(C)C)c2n1.
What is the InChIKey of 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine?
The InChIKey is WEVJARQRNLGBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4OSi/c1-10-5-6-11-12(14)16-17(13(11)15-10)9-18-7-8-19(2,3)4/h5-6H,7-9H2,1-4H3,(H2,14,16).
What are the key properties of 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine?
6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine has a molecular weight of 278.43 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-amine is sourced from PubChem (CID 141449114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).