C2H5N3S2 — CID 141449162
1,2-dihydro-1,2,4-triazole-3,3-dithiol (PubChem CID 141449162) has the molecular formula C2H5N3S2 and a molecular weight of 135.22 g/mol. Its IUPAC name is 1,2-dihydro-1,2,4-triazole-3,3-dithiol.
| Compound Name | 1,2-dihydro-1,2,4-triazole-3,3-dithiol |
|---|---|
| PubChem CID | 141449162 |
| Molecular Formula | C2H5N3S2 |
| Molecular Weight | 135.22 g/mol |
| Exact Mass | 134.99 |
| IUPAC Name | 1,2-dihydro-1,2,4-triazole-3,3-dithiol |
| SMILES | SC1(S)N=CNN1 |
| InChI | InChI=1S/C2H5N3S2/c6-2(7)3-1-4-5-2/h1,5-7H,(H,3,4) |
| InChIKey | AWVSDDBYSPOFBB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|