C46H48N2O2 — CID 141449620
5,11-dihexyl-6,12-bis(4-methylphenyl)indolo[3,2-b]carbazole-2,8-dicarbaldehyde (PubChem CID 141449620) has the molecular formula C46H48N2O2 and a molecular weight of 660.90 g/mol. Its IUPAC name is 5,11-dihexyl-6,12-bis(4-methylphenyl)indolo[3,2-b]carbazole-2,8-dicarbaldehyde.
| Compound Name | 5,11-dihexyl-6,12-bis(4-methylphenyl)indolo[3,2-b]carbazole-2,8-dicarbaldehyde |
|---|---|
| PubChem CID | 141449620 |
| Molecular Formula | C46H48N2O2 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.37 |
| IUPAC Name | 5,11-dihexyl-6,12-bis(4-methylphenyl)indolo[3,2-b]carbazole-2,8-dicarbaldehyde |
| SMILES | CCCCCCn1c2ccc(C=O)cc2c2c(-c3ccc(C)cc3)c3c(c(-c4ccc(C)cc4)c21)c1cc(C=O)ccc1n3CCCCCC |
| InChI | InChI=1S/C46H48N2O2/c1-5-7-9-11-25-47-39-23-17-33(29-49)27-37(39)43-42(36-21-15-32(4)16-22-36)46-44(41(45(43)47)35-19-13-31(3)14-20-35)38-28-34(30-50)18-24-40(38)48(46)26-12-10-8-6-2/h13-24,27-30H,5-12,25-26H2,1-4H3 |
| InChIKey | ALEYNUMQOKLXCH-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|