About 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid
1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid (PubChem CID 14144974) has the molecular formula C5H7O6P
and a molecular weight of 194.08 g/mol. Its IUPAC name is 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid |
| PubChem CID | 14144974 |
| Molecular Formula | C5H7O6P |
| Molecular Weight | 194.08 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid |
| SMILES | O=C(O)C12COP(=O)(OC1)OC2 |
| InChI | InChI=1S/C5H7O6P/c6-4(7)5-1-9-12(8,10-2-5)11-3-5/h1-3H2,(H,6,7) |
| InChIKey | LRCNNSSGYIOSAF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.08 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid?
The IUPAC name of 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid (CID 14144974) is 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid.
What is the SMILES notation for 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid?
The canonical SMILES for 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid is O=C(O)C12COP(=O)(OC1)OC2.
What is the InChIKey of 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid?
The InChIKey is LRCNNSSGYIOSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7O6P/c6-4(7)5-1-9-12(8,10-2-5)11-3-5/h1-3H2,(H,6,7).
What are the key properties of 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid?
1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid has a molecular weight of 194.08 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-2,6,7-trioxa-1lambda5-phosphabicyclo[2.2.2]octane-4-carboxylic acid is sourced from PubChem (CID 14144974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).