C10H17NO6 — CID 141450113
propan-2-yl (3R,5S)-3,5-dihydroxy-7-nitrohept-6-enoate (PubChem CID 141450113) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is propan-2-yl (3R,5S)-3,5-dihydroxy-7-nitrohept-6-enoate.
| Compound Name | propan-2-yl (3R,5S)-3,5-dihydroxy-7-nitrohept-6-enoate |
|---|---|
| PubChem CID | 141450113 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | propan-2-yl (3R,5S)-3,5-dihydroxy-7-nitrohept-6-enoate |
| SMILES | CC(C)OC(=O)C[C@H](O)C[C@H](O)C=C[N+](=O)[O-] |
| InChI | InChI=1S/C10H17NO6/c1-7(2)17-10(14)6-9(13)5-8(12)3-4-11(15)16/h3-4,7-9,12-13H,5-6H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | HQIVXKLWOKCURO-RKDXNWHRSA-N |
| XLogP | 0.23 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|