About 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene
2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene (PubChem CID 141450206) has the molecular formula C19H26N2O2
and a molecular weight of 314.43 g/mol. Its IUPAC name is 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene |
| PubChem CID | 141450206 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene |
| SMILES | CC(C)Cc1cc(C(C)C)c(N=C=O)c(CC(C)C)c1N=C=O |
| InChI | InChI=1S/C19H26N2O2/c1-12(2)7-15-9-16(14(5)6)19(21-11-23)17(8-13(3)4)18(15)20-10-22/h9,12-14H,7-8H2,1-6H3 |
| InChIKey | YMRDKEKSOFVCED-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene?
The IUPAC name of 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene (CID 141450206) is 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene.
What is the SMILES notation for 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene?
The canonical SMILES for 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene is CC(C)Cc1cc(C(C)C)c(N=C=O)c(CC(C)C)c1N=C=O.
What is the InChIKey of 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene?
The InChIKey is YMRDKEKSOFVCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O2/c1-12(2)7-15-9-16(14(5)6)19(21-11-23)17(8-13(3)4)18(15)20-10-22/h9,12-14H,7-8H2,1-6H3.
What are the key properties of 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene?
2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene has a molecular weight of 314.43 g/mol, XLogP of 5.14, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diisocyanato-1,3-bis(2-methylpropyl)-5-propan-2-ylbenzene is sourced from PubChem (CID 141450206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).