C14H16ClN3O4S — CID 141451056
[(2E)-2-[(2,4-dihydroxyphenyl)methylhydrazinylidene]ethyl] 4-methyl-1,3-thiazole-5-carboxylate;hydrochloride (PubChem CID 141451056) has the molecular formula C14H16ClN3O4S and a molecular weight of 357.82 g/mol. Its IUPAC name is [(2E)-2-[(2,4-dihydroxyphenyl)methylhydrazinylidene]ethyl] 4-methyl-1,3-thiazole-5-carboxylate;hydrochloride.
| Compound Name | [(2E)-2-[(2,4-dihydroxyphenyl)methylhydrazinylidene]ethyl] 4-methyl-1,3-thiazole-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 141451056 |
| Molecular Formula | C14H16ClN3O4S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [(2E)-2-[(2,4-dihydroxyphenyl)methylhydrazinylidene]ethyl] 4-methyl-1,3-thiazole-5-carboxylate;hydrochloride |
| SMILES | Cc1ncsc1C(=O)OC/C=N/NCc1ccc(O)cc1O.Cl |
| InChI | InChI=1S/C14H15N3O4S.ClH/c1-9-13(22-8-15-9)14(20)21-5-4-16-17-7-10-2-3-11(18)6-12(10)19;/h2-4,6,8,17-19H,5,7H2,1H3;1H/b16-4+; |
| InChIKey | CRWKTOPJIFYULX-CQCNNJTASA-N |
| XLogP | 2.22 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|