C9H15NO3S — CID 141451810
2,2,6,6-tetramethyl-3-sulfonylpiperidin-4-one (PubChem CID 141451810) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-3-sulfonylpiperidin-4-one.
| Compound Name | 2,2,6,6-tetramethyl-3-sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 141451810 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2,2,6,6-tetramethyl-3-sulfonylpiperidin-4-one |
| SMILES | CC1(C)CC(=O)C(=S(=O)=O)C(C)(C)N1 |
| InChI | InChI=1S/C9H15NO3S/c1-8(2)5-6(11)7(14(12)13)9(3,4)10-8/h10H,5H2,1-4H3 |
| InChIKey | GCLSUPIQPAPOEF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|