C22H34O4 — CID 141451976
2-methylprop-2-enoyl (9Z,12Z,15Z)-2-hydroxyoctadeca-9,12,15-trienoate (PubChem CID 141451976) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-methylprop-2-enoyl (9Z,12Z,15Z)-2-hydroxyoctadeca-9,12,15-trienoate.
| Compound Name | 2-methylprop-2-enoyl (9Z,12Z,15Z)-2-hydroxyoctadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 141451976 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-methylprop-2-enoyl (9Z,12Z,15Z)-2-hydroxyoctadeca-9,12,15-trienoate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)CCCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C22H34O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(23)22(25)26-21(24)19(2)3/h5-6,8-9,11-12,20,23H,2,4,7,10,13-18H2,1,3H3/b6-5-,9-8-,12-11- |
| InChIKey | FBCSYIUXRWGVCL-AGRJPVHOSA-N |
| XLogP | 5.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|