About 1,1-diaminobut-2-en-2-ol
1,1-diaminobut-2-en-2-ol (PubChem CID 141451987) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is 1,1-diaminobut-2-en-2-ol.
Molecular Properties
| Compound Name | 1,1-diaminobut-2-en-2-ol |
| PubChem CID | 141451987 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | 1,1-diaminobut-2-en-2-ol |
| SMILES | CC=C(O)C(N)N |
| InChI | InChI=1S/C4H10N2O/c1-2-3(7)4(5)6/h2,4,7H,5-6H2,1H3 |
| InChIKey | OVHZXQHYCLPKLD-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diaminobut-2-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diaminobut-2-en-2-ol?
The IUPAC name of 1,1-diaminobut-2-en-2-ol (CID 141451987) is 1,1-diaminobut-2-en-2-ol.
What is the SMILES notation for 1,1-diaminobut-2-en-2-ol?
The canonical SMILES for 1,1-diaminobut-2-en-2-ol is CC=C(O)C(N)N.
What is the InChIKey of 1,1-diaminobut-2-en-2-ol?
The InChIKey is OVHZXQHYCLPKLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-2-3(7)4(5)6/h2,4,7H,5-6H2,1H3.
What are the key properties of 1,1-diaminobut-2-en-2-ol?
1,1-diaminobut-2-en-2-ol has a molecular weight of 102.14 g/mol, XLogP of -0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diaminobut-2-en-2-ol is sourced from PubChem (CID 141451987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).