C16H21NO5 — CID 141452248
ethyl (2S)-1-[2-(4-hydroxyphenoxy)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 141452248) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl (2S)-1-[2-(4-hydroxyphenoxy)propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[2-(4-hydroxyphenoxy)propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141452248 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | ethyl (2S)-1-[2-(4-hydroxyphenoxy)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN1C(=O)C(C)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C16H21NO5/c1-3-21-16(20)14-5-4-10-17(14)15(19)11(2)22-13-8-6-12(18)7-9-13/h6-9,11,14,18H,3-5,10H2,1-2H3/t11?,14-/m0/s1 |
| InChIKey | RCJNKJMBXBVCMP-IAXJKZSUSA-N |
| XLogP | 1.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |