About 2-(2-fluorophenyl)-2,2-dinitroacetonitrile
2-(2-fluorophenyl)-2,2-dinitroacetonitrile (PubChem CID 141453913) has the molecular formula C8H4FN3O4
and a molecular weight of 225.14 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-2,2-dinitroacetonitrile.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-2,2-dinitroacetonitrile |
| PubChem CID | 141453913 |
| Molecular Formula | C8H4FN3O4 |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2-(2-fluorophenyl)-2,2-dinitroacetonitrile |
| SMILES | N#CC(c1ccccc1F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C8H4FN3O4/c9-7-4-2-1-3-6(7)8(5-10,11(13)14)12(15)16/h1-4H |
| InChIKey | SNEWUBZNRYSUII-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluorophenyl)-2,2-dinitroacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-2,2-dinitroacetonitrile?
The IUPAC name of 2-(2-fluorophenyl)-2,2-dinitroacetonitrile (CID 141453913) is 2-(2-fluorophenyl)-2,2-dinitroacetonitrile.
What is the SMILES notation for 2-(2-fluorophenyl)-2,2-dinitroacetonitrile?
The canonical SMILES for 2-(2-fluorophenyl)-2,2-dinitroacetonitrile is N#CC(c1ccccc1F)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-(2-fluorophenyl)-2,2-dinitroacetonitrile?
The InChIKey is SNEWUBZNRYSUII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4FN3O4/c9-7-4-2-1-3-6(7)8(5-10,11(13)14)12(15)16/h1-4H.
What are the key properties of 2-(2-fluorophenyl)-2,2-dinitroacetonitrile?
2-(2-fluorophenyl)-2,2-dinitroacetonitrile has a molecular weight of 225.14 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-2,2-dinitroacetonitrile is sourced from PubChem (CID 141453913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).