About methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate
methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate (PubChem CID 141454020) has the molecular formula C5H4BrN3O4S
and a molecular weight of 282.08 g/mol. Its IUPAC name is methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 141454020 |
| Molecular Formula | C5H4BrN3O4S |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.91 |
| IUPAC Name | methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate |
| SMILES | COC(=O)Nc1nc([N+](=O)[O-])c(Br)s1 |
| InChI | InChI=1S/C5H4BrN3O4S/c1-13-5(10)8-4-7-3(9(11)12)2(6)14-4/h1H3,(H,7,8,10) |
| InChIKey | WHUPKMSEIPSRHR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate?
The IUPAC name of methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate (CID 141454020) is methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate is COC(=O)Nc1nc([N+](=O)[O-])c(Br)s1.
What is the InChIKey of methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate?
The InChIKey is WHUPKMSEIPSRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrN3O4S/c1-13-5(10)8-4-7-3(9(11)12)2(6)14-4/h1H3,(H,7,8,10).
What are the key properties of methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate?
methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate has a molecular weight of 282.08 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(5-bromo-4-nitro-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 141454020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).