About methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate
methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate (PubChem CID 141454021) has the molecular formula C5H7BrN2O2S
and a molecular weight of 239.09 g/mol. Its IUPAC name is methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate |
| PubChem CID | 141454021 |
| Molecular Formula | C5H7BrN2O2S |
| Molecular Weight | 239.09 g/mol |
| Exact Mass | 237.94 |
| IUPAC Name | methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate |
| SMILES | COC(=O)N1C=C(Br)SC1N |
| InChI | InChI=1S/C5H7BrN2O2S/c1-10-5(9)8-2-3(6)11-4(8)7/h2,4H,7H2,1H3 |
| InChIKey | JHAAQNWCMPGFAT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.09 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate?
The IUPAC name of methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate (CID 141454021) is methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate.
What is the SMILES notation for methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate?
The canonical SMILES for methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate is COC(=O)N1C=C(Br)SC1N.
What is the InChIKey of methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate?
The InChIKey is JHAAQNWCMPGFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrN2O2S/c1-10-5(9)8-2-3(6)11-4(8)7/h2,4H,7H2,1H3.
What are the key properties of methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate?
methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate has a molecular weight of 239.09 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-5-bromo-2H-1,3-thiazole-3-carboxylate is sourced from PubChem (CID 141454021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).