About ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate
ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate (PubChem CID 141454255) has the molecular formula C16H17N3O4S
and a molecular weight of 347.40 g/mol. Its IUPAC name is ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate |
| PubChem CID | 141454255 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1nnc(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H17N3O4S/c1-2-23-14(21)9-12(20)10-24-16-17-15(22)13(18-19-16)8-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,17,19,22) |
| InChIKey | PSEMAGQIKSWKHB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate?
The IUPAC name of ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate (CID 141454255) is ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate.
What is the SMILES notation for ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate?
The canonical SMILES for ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate is CCOC(=O)CC(=O)CSc1nnc(Cc2ccccc2)c(=O)[nH]1.
What is the InChIKey of ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate?
The InChIKey is PSEMAGQIKSWKHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O4S/c1-2-23-14(21)9-12(20)10-24-16-17-15(22)13(18-19-16)8-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,17,19,22).
What are the key properties of ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate?
ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate has a molecular weight of 347.40 g/mol, XLogP of 1.37, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(6-benzyl-5-oxo-4H-1,2,4-triazin-3-yl)sulfanyl]-3-oxobutanoate is sourced from PubChem (CID 141454255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).