C9H10Cl2N2 — CID 14145430
2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 14145430) has the molecular formula C9H10Cl2N2 and a molecular weight of 217.10 g/mol. Its IUPAC name is 2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 14145430 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 2,4-dichloro-7-methyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | CC1CCc2c(Cl)nc(Cl)nc2C1 |
| InChI | InChI=1S/C9H10Cl2N2/c1-5-2-3-6-7(4-5)12-9(11)13-8(6)10/h5H,2-4H2,1H3 |
| InChIKey | FZDKNAIGQIBILC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |