C9H14N2 — CID 14145447
2,6-dimethyl-4,5,6,7-tetrahydroindazole (PubChem CID 14145447) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,6-dimethyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 2,6-dimethyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 14145447 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2,6-dimethyl-4,5,6,7-tetrahydroindazole |
| SMILES | CC1CCc2cn(C)nc2C1 |
| InChI | InChI=1S/C9H14N2/c1-7-3-4-8-6-11(2)10-9(8)5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | LELATABAXXWUHQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |