About (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate
(4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate (PubChem CID 141454805) has the molecular formula C12H12FNO5
and a molecular weight of 269.23 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate |
| PubChem CID | 141454805 |
| Molecular Formula | C12H12FNO5 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate |
| SMILES | CC(F)C(=O)CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12FNO5/c1-8(13)11(15)6-12(16)19-7-9-2-4-10(5-3-9)14(17)18/h2-5,8H,6-7H2,1H3 |
| InChIKey | ZHZKDYRYJXGPCQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate?
The IUPAC name of (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate (CID 141454805) is (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate.
What is the SMILES notation for (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate?
The canonical SMILES for (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate is CC(F)C(=O)CC(=O)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate?
The InChIKey is ZHZKDYRYJXGPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO5/c1-8(13)11(15)6-12(16)19-7-9-2-4-10(5-3-9)14(17)18/h2-5,8H,6-7H2,1H3.
What are the key properties of (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate?
(4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate has a molecular weight of 269.23 g/mol, XLogP of 1.96, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl 4-fluoro-3-oxopentanoate is sourced from PubChem (CID 141454805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).