About ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride
ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride (PubChem CID 141454887) has the molecular formula C15H20Cl3N3O3
and a molecular weight of 396.70 g/mol. Its IUPAC name is ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride |
| PubChem CID | 141454887 |
| Molecular Formula | C15H20Cl3N3O3 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)c1cc(-c2cccc(Cl)c2)nn1C(CN)CO.Cl.Cl |
| InChI | InChI=1S/C15H18ClN3O3.2ClH/c1-2-22-15(21)14-7-13(10-4-3-5-11(16)6-10)18-19(14)12(8-17)9-20;;/h3-7,12,20H,2,8-9,17H2,1H3;2*1H |
| InChIKey | NEAFIXDWEVBOQB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride?
The IUPAC name of ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride (CID 141454887) is ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride.
What is the SMILES notation for ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride?
The canonical SMILES for ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride is CCOC(=O)c1cc(-c2cccc(Cl)c2)nn1C(CN)CO.Cl.Cl.
What is the InChIKey of ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride?
The InChIKey is NEAFIXDWEVBOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O3.2ClH/c1-2-22-15(21)14-7-13(10-4-3-5-11(16)6-10)18-19(14)12(8-17)9-20;;/h3-7,12,20H,2,8-9,17H2,1H3;2*1H.
What are the key properties of ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride?
ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride has a molecular weight of 396.70 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(1-amino-3-hydroxypropan-2-yl)-3-(3-chlorophenyl)pyrazole-5-carboxylate;dihydrochloride is sourced from PubChem (CID 141454887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).