C10H14N2O3 — CID 141455296
2-hydroxy-1,2-dimethylcyclohexa-3,5-diene-1,3-dicarboxamide (PubChem CID 141455296) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-hydroxy-1,2-dimethylcyclohexa-3,5-diene-1,3-dicarboxamide.
| Compound Name | 2-hydroxy-1,2-dimethylcyclohexa-3,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141455296 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-hydroxy-1,2-dimethylcyclohexa-3,5-diene-1,3-dicarboxamide |
| SMILES | CC1(O)C(C(N)=O)=CC=CC1(C)C(N)=O |
| InChI | InChI=1S/C10H14N2O3/c1-9(8(12)14)5-3-4-6(7(11)13)10(9,2)15/h3-5,15H,1-2H3,(H2,11,13)(H2,12,14) |
| InChIKey | UCZMFKNNVLTAFO-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |