About [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate
[2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate (PubChem CID 141455346) has the molecular formula C24H20N2O5
and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate.
Molecular Properties
| Compound Name | [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate |
| PubChem CID | 141455346 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(C)ccc1/N=N/c1c(O)ccc(C(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C24H20N2O5/c1-3-21(28)31-14-17-13-15(2)9-11-19(17)25-26-22-20(27)12-10-18(24(22)30)23(29)16-7-5-4-6-8-16/h3-13,27,30H,1,14H2,2H3/b26-25+ |
| InChIKey | NDVIANMEQMLOGK-OCEACIFDSA-N |
| XLogP | 5.28 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate?
The IUPAC name of [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate (CID 141455346) is [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate.
What is the SMILES notation for [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate?
The canonical SMILES for [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate is C=CC(=O)OCc1cc(C)ccc1/N=N/c1c(O)ccc(C(=O)c2ccccc2)c1O.
What is the InChIKey of [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate?
The InChIKey is NDVIANMEQMLOGK-OCEACIFDSA-N. The full InChI is InChI=1S/C24H20N2O5/c1-3-21(28)31-14-17-13-15(2)9-11-19(17)25-26-22-20(27)12-10-18(24(22)30)23(29)16-7-5-4-6-8-16/h3-13,27,30H,1,14H2,2H3/b26-25+.
What are the key properties of [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate?
[2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate has a molecular weight of 416.43 g/mol, XLogP of 5.28, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-5-methylphenyl]methyl prop-2-enoate is sourced from PubChem (CID 141455346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).