C17H33FN4 — CID 141456619
(10R,14S)-4-fluoro-10-methyl-5,8,16-triazatricyclo[13.3.1.02,7]nonadecan-14-amine (PubChem CID 141456619) has the molecular formula C17H33FN4 and a molecular weight of 312.48 g/mol. Its IUPAC name is (10R,14S)-4-fluoro-10-methyl-5,8,16-triazatricyclo[13.3.1.02,7]nonadecan-14-amine.
| Compound Name | (10R,14S)-4-fluoro-10-methyl-5,8,16-triazatricyclo[13.3.1.02,7]nonadecan-14-amine |
|---|---|
| PubChem CID | 141456619 |
| Molecular Formula | C17H33FN4 |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | (10R,14S)-4-fluoro-10-methyl-5,8,16-triazatricyclo[13.3.1.02,7]nonadecan-14-amine |
| SMILES | C[C@@H]1CCC[C@H](N)C2CC(CCN2)C2CC(F)NCC2NC1 |
| InChI | InChI=1S/C17H33FN4/c1-11-3-2-4-14(19)15-7-12(5-6-20-15)13-8-17(18)22-10-16(13)21-9-11/h11-17,20-22H,2-10,19H2,1H3/t11-,12?,13?,14+,15?,16?,17?/m1/s1 |
| InChIKey | QZJZSZFBZMMUIR-KJGVXDFPSA-N |
| XLogP | 1.37 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|