C28H36Cl2FN9O — CID 141456635
6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-3-[(9R,13S)-3,9-dimethyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadecan-13-yl]-5-fluoropyrimidin-4-one (PubChem CID 141456635) has the molecular formula C28H36Cl2FN9O and a molecular weight of 604.56 g/mol. Its IUPAC name is 6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-3-[(9R,13S)-3,9-dimethyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadecan-13-yl]-5-fluoropyrimidin-4-one.
| Compound Name | 6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-3-[(9R,13S)-3,9-dimethyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadecan-13-yl]-5-fluoropyrimidin-4-one |
|---|---|
| PubChem CID | 141456635 |
| Molecular Formula | C28H36Cl2FN9O |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 6-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-3-[(9R,13S)-3,9-dimethyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadecan-13-yl]-5-fluoropyrimidin-4-one |
| SMILES | C[C@@H]1CCC[C@H](n2cnc(-c3cc(Cl)ccc3-n3cc(Cl)nn3)c(F)c2=O)C2CC(CCN2)C2C(CNN2C)NC1 |
| InChI | InChI=1S/C28H36Cl2FN9O/c1-16-4-3-5-23(20-10-17(8-9-32-20)27-21(33-12-16)13-35-38(27)2)39-15-34-26(25(31)28(39)41)19-11-18(29)6-7-22(19)40-14-24(30)36-37-40/h6-7,11,14-17,20-21,23,27,32-33,35H,3-5,8-10,12-13H2,1-2H3/t16-,17?,20?,21?,23+,27?/m1/s1 |
| InChIKey | JSDDMTIWRLJFTR-DQSWHTIJSA-N |
| XLogP | 3.44 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |