About 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol
5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol (PubChem CID 141456855) has the molecular formula C12H6F4O2S2
and a molecular weight of 322.30 g/mol. Its IUPAC name is 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol.
Molecular Properties
| Compound Name | 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol |
| PubChem CID | 141456855 |
| Molecular Formula | C12H6F4O2S2 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol |
| SMILES | Oc1cc(SSc2cc(O)c(F)cc2F)c(F)cc1F |
| InChI | InChI=1S/C12H6F4O2S2/c13-5-1-7(15)11(3-9(5)17)19-20-12-4-10(18)6(14)2-8(12)16/h1-4,17-18H |
| InChIKey | LYBBZAKYOWAIOF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol?
The IUPAC name of 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol (CID 141456855) is 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol.
What is the SMILES notation for 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol?
The canonical SMILES for 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol is Oc1cc(SSc2cc(O)c(F)cc2F)c(F)cc1F.
What is the InChIKey of 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol?
The InChIKey is LYBBZAKYOWAIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F4O2S2/c13-5-1-7(15)11(3-9(5)17)19-20-12-4-10(18)6(14)2-8(12)16/h1-4,17-18H.
What are the key properties of 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol?
5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol has a molecular weight of 322.30 g/mol, XLogP of 4.45, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-difluoro-5-hydroxyphenyl)disulfanyl]-2,4-difluorophenol is sourced from PubChem (CID 141456855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).