C21H17ClF4N4O — CID 141457660
N-[1-(4-chlorophthalazin-1-yl)piperidin-3-yl]-4-fluoro-2-(trifluoromethyl)benzamide (PubChem CID 141457660) has the molecular formula C21H17ClF4N4O and a molecular weight of 452.84 g/mol. Its IUPAC name is N-[1-(4-chlorophthalazin-1-yl)piperidin-3-yl]-4-fluoro-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(4-chlorophthalazin-1-yl)piperidin-3-yl]-4-fluoro-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141457660 |
| Molecular Formula | C21H17ClF4N4O |
| Molecular Weight | 452.84 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-[1-(4-chlorophthalazin-1-yl)piperidin-3-yl]-4-fluoro-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCCN(c2nnc(Cl)c3ccccc23)C1)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H17ClF4N4O/c22-18-14-5-1-2-6-15(14)19(29-28-18)30-9-3-4-13(11-30)27-20(31)16-8-7-12(23)10-17(16)21(24,25)26/h1-2,5-8,10,13H,3-4,9,11H2,(H,27,31) |
| InChIKey | AZTQMRNCEAOFJJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |