C9H10O3 — CID 141457774
4,7-dihydroxy-2,3,4,5-tetrahydroinden-1-one (PubChem CID 141457774) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4,7-dihydroxy-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 4,7-dihydroxy-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 141457774 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4,7-dihydroxy-2,3,4,5-tetrahydroinden-1-one |
| SMILES | O=C1CCC2=C1C(O)=CCC2O |
| InChI | InChI=1S/C9H10O3/c10-6-3-4-8(12)9-5(6)1-2-7(9)11/h4,6,10,12H,1-3H2 |
| InChIKey | PWPPICXMUDLNRV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |