C17H15N5O2S — CID 141457987
2-methoxy-5-[3-(3-methoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline (PubChem CID 141457987) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 2-methoxy-5-[3-(3-methoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline.
| Compound Name | 2-methoxy-5-[3-(3-methoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline |
|---|---|
| PubChem CID | 141457987 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-methoxy-5-[3-(3-methoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline |
| SMILES | COc1cccc(-c2nnc3sc(-c4ccc(OC)c(N)c4)nn23)c1 |
| InChI | InChI=1S/C17H15N5O2S/c1-23-12-5-3-4-10(8-12)15-19-20-17-22(15)21-16(25-17)11-6-7-14(24-2)13(18)9-11/h3-9H,18H2,1-2H3 |
| InChIKey | NKFKAEHSPCOHQB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|