C19H19ClF3N3O4 — CID 141458166
methyl 2-[6-chloro-4-[1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylcarbamoyl]-2-pyridinyl]acetate (PubChem CID 141458166) has the molecular formula C19H19ClF3N3O4 and a molecular weight of 445.83 g/mol. Its IUPAC name is methyl 2-[6-chloro-4-[1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylcarbamoyl]-2-pyridinyl]acetate.
| Compound Name | methyl 2-[6-chloro-4-[1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylcarbamoyl]-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 141458166 |
| Molecular Formula | C19H19ClF3N3O4 |
| Molecular Weight | 445.83 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | methyl 2-[6-chloro-4-[1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylcarbamoyl]-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(C(=O)NC(C)c2cnc(OCC(F)(F)F)c(C)c2)cc(Cl)n1 |
| InChI | InChI=1S/C19H19ClF3N3O4/c1-10-4-13(8-24-18(10)30-9-19(21,22)23)11(2)25-17(28)12-5-14(7-16(27)29-3)26-15(20)6-12/h4-6,8,11H,7,9H2,1-3H3,(H,25,28) |
| InChIKey | HPYMFBKVDHASTE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|