C17H19Cl2N5O2 — CID 141459382
4-chloro-N-[2-[4-(6-chloropyrimidin-4-yl)piperazin-1-yl]-2-hydroxyethyl]benzamide (PubChem CID 141459382) has the molecular formula C17H19Cl2N5O2 and a molecular weight of 396.28 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(6-chloropyrimidin-4-yl)piperazin-1-yl]-2-hydroxyethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[4-(6-chloropyrimidin-4-yl)piperazin-1-yl]-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 141459382 |
| Molecular Formula | C17H19Cl2N5O2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-chloro-N-[2-[4-(6-chloropyrimidin-4-yl)piperazin-1-yl]-2-hydroxyethyl]benzamide |
| SMILES | O=C(NCC(O)N1CCN(c2cc(Cl)ncn2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2N5O2/c18-13-3-1-12(2-4-13)17(26)20-10-16(25)24-7-5-23(6-8-24)15-9-14(19)21-11-22-15/h1-4,9,11,16,25H,5-8,10H2,(H,20,26) |
| InChIKey | OZEMSJRNFRYZMA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |