C26H34F2O8 — CID 141459514
(2S,3R,4R,5R)-4,6-bis[(2-fluoro-5-methoxyphenyl)methyl]-8-methylnon-8-ene-1,2,3,4,5,6-hexol (PubChem CID 141459514) has the molecular formula C26H34F2O8 and a molecular weight of 512.55 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(2-fluoro-5-methoxyphenyl)methyl]-8-methylnon-8-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(2-fluoro-5-methoxyphenyl)methyl]-8-methylnon-8-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459514 |
| Molecular Formula | C26H34F2O8 |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(2-fluoro-5-methoxyphenyl)methyl]-8-methylnon-8-ene-1,2,3,4,5,6-hexol |
| SMILES | C=C(C)CC(O)(Cc1cc(OC)ccc1F)[C@@H](O)[C@@](O)(Cc1cc(OC)ccc1F)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C26H34F2O8/c1-15(2)11-25(33,12-16-9-18(35-3)5-7-20(16)27)24(32)26(34,23(31)22(30)14-29)13-17-10-19(36-4)6-8-21(17)28/h5-10,22-24,29-34H,1,11-14H2,2-4H3/t22-,23+,24+,25?,26+/m0/s1 |
| InChIKey | JKBVLHYIDKHUHP-KALDWRKLSA-N |
| XLogP | 1.27 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|