C23H20F8O6 — CID 141459529
(2S,3R,4R,5R)-10-(2,3,4,6-tetrafluorophenyl)-7-[(2,3,4,6-tetrafluorophenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol (PubChem CID 141459529) has the molecular formula C23H20F8O6 and a molecular weight of 544.39 g/mol. Its IUPAC name is (2S,3R,4R,5R)-10-(2,3,4,6-tetrafluorophenyl)-7-[(2,3,4,6-tetrafluorophenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-10-(2,3,4,6-tetrafluorophenyl)-7-[(2,3,4,6-tetrafluorophenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459529 |
| Molecular Formula | C23H20F8O6 |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | (2S,3R,4R,5R)-10-(2,3,4,6-tetrafluorophenyl)-7-[(2,3,4,6-tetrafluorophenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)C(=C=CCc1c(F)cc(F)c(F)c1F)Cc1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/C23H20F8O6/c24-11-5-13(26)18(30)16(28)9(11)3-1-2-8(4-10-12(25)6-14(27)19(31)17(10)29)20(34)22(36)23(37)21(35)15(33)7-32/h1,5-6,15,20-23,32-37H,3-4,7H2/t2?,15-,20?,21+,22+,23-/m0/s1 |
| InChIKey | FIFAFRIWFYEBCO-QXZCUVFPSA-N |
| XLogP | 1.46 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|