C28H40O6 — CID 141459553
(2S,3R,4R,5R)-4,6-bis[(2-propan-2-ylphenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol (PubChem CID 141459553) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(2-propan-2-ylphenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(2-propan-2-ylphenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459553 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(2-propan-2-ylphenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol |
| SMILES | C=CC(O)(Cc1ccccc1C(C)C)[C@@H](O)[C@@](O)(Cc1ccccc1C(C)C)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C28H40O6/c1-6-27(33,15-20-11-7-9-13-22(20)18(2)3)26(32)28(34,25(31)24(30)17-29)16-21-12-8-10-14-23(21)19(4)5/h6-14,18-19,24-26,29-34H,1,15-17H2,2-5H3/t24-,25+,26+,27?,28+/m0/s1 |
| InChIKey | APGFHGJLCMBRSU-XKXYPLPJSA-N |
| XLogP | 2.44 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|