C23H26F6O6 — CID 141459715
(2S,3R,4R,5R)-4,6-bis[(3,4,5-trifluorophenyl)methyl]nonane-1,2,3,4,5,6-hexol (PubChem CID 141459715) has the molecular formula C23H26F6O6 and a molecular weight of 512.44 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(3,4,5-trifluorophenyl)methyl]nonane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(3,4,5-trifluorophenyl)methyl]nonane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459715 |
| Molecular Formula | C23H26F6O6 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(3,4,5-trifluorophenyl)methyl]nonane-1,2,3,4,5,6-hexol |
| SMILES | CCCC(O)(Cc1cc(F)c(F)c(F)c1)[C@@H](O)[C@@](O)(Cc1cc(F)c(F)c(F)c1)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C23H26F6O6/c1-2-3-22(34,8-11-4-13(24)18(28)14(25)5-11)21(33)23(35,20(32)17(31)10-30)9-12-6-15(26)19(29)16(27)7-12/h4-7,17,20-21,30-35H,2-3,8-10H2,1H3/t17-,20+,21+,22?,23+/m0/s1 |
| InChIKey | ORUCHLPUBLQWHD-VRXTYWPTSA-N |
| XLogP | 1.64 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|