C28H40O12 — CID 141459717
(2S,3R,4R,5R)-4,6-bis[(2,3,6-trimethoxyphenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol (PubChem CID 141459717) has the molecular formula C28H40O12 and a molecular weight of 568.62 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(2,3,6-trimethoxyphenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(2,3,6-trimethoxyphenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459717 |
| Molecular Formula | C28H40O12 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(2,3,6-trimethoxyphenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol |
| SMILES | C=CC(O)(Cc1c(OC)ccc(OC)c1OC)[C@@H](O)[C@@](O)(Cc1c(OC)ccc(OC)c1OC)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C28H40O12/c1-8-27(33,13-16-19(35-2)9-11-21(37-4)23(16)39-6)26(32)28(34,25(31)18(30)15-29)14-17-20(36-3)10-12-22(38-5)24(17)40-7/h8-12,18,25-26,29-34H,1,13-15H2,2-7H3/t18-,25+,26+,27?,28+/m0/s1 |
| InChIKey | GJXHCHHOQBPCRA-QBPPRZAKSA-N |
| XLogP | 0.25 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|