C26H32F4O6 — CID 141460065
(2S,3R,4R,5R)-4,6-bis[(4-ethyl-3,5-difluorophenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol (PubChem CID 141460065) has the molecular formula C26H32F4O6 and a molecular weight of 516.53 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(4-ethyl-3,5-difluorophenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(4-ethyl-3,5-difluorophenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141460065 |
| Molecular Formula | C26H32F4O6 |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(4-ethyl-3,5-difluorophenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol |
| SMILES | C=CC(O)(Cc1cc(F)c(CC)c(F)c1)[C@@H](O)[C@@](O)(Cc1cc(F)c(CC)c(F)c1)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C26H32F4O6/c1-4-16-18(27)7-14(8-19(16)28)11-25(35,6-3)24(34)26(36,23(33)22(32)13-31)12-15-9-20(29)17(5-2)21(30)10-15/h6-10,22-24,31-36H,3-5,11-13H2,1-2H3/t22-,23+,24+,25?,26+/m0/s1 |
| InChIKey | LYMQZHLQLUEYFP-KALDWRKLSA-N |
| XLogP | 1.88 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|