C23H24F4O6 — CID 141460096
(2S,3R,4R,5R)-10-(2,4-difluorophenyl)-7-[(2,4-difluorophenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol (PubChem CID 141460096) has the molecular formula C23H24F4O6 and a molecular weight of 472.43 g/mol. Its IUPAC name is (2S,3R,4R,5R)-10-(2,4-difluorophenyl)-7-[(2,4-difluorophenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-10-(2,4-difluorophenyl)-7-[(2,4-difluorophenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141460096 |
| Molecular Formula | C23H24F4O6 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (2S,3R,4R,5R)-10-(2,4-difluorophenyl)-7-[(2,4-difluorophenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)C(=C=CCc1ccc(F)cc1F)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C23H24F4O6/c24-15-6-4-12(17(26)9-15)2-1-3-14(8-13-5-7-16(25)10-18(13)27)20(30)22(32)23(33)21(31)19(29)11-28/h1,4-7,9-10,19-23,28-33H,2,8,11H2/t3?,19-,20?,21+,22+,23-/m0/s1 |
| InChIKey | XJSFXJARRBBTIO-UDKRZHOOSA-N |
| XLogP | 0.91 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |