C22H26F2O6 — CID 141460146
(2S,3R,4R,5R)-4,6-bis[(4-fluorophenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol (PubChem CID 141460146) has the molecular formula C22H26F2O6 and a molecular weight of 424.44 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4,6-bis[(4-fluorophenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-4,6-bis[(4-fluorophenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141460146 |
| Molecular Formula | C22H26F2O6 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (2S,3R,4R,5R)-4,6-bis[(4-fluorophenyl)methyl]oct-7-ene-1,2,3,4,5,6-hexol |
| SMILES | C=CC(O)(Cc1ccc(F)cc1)[C@@H](O)[C@@](O)(Cc1ccc(F)cc1)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C22H26F2O6/c1-2-21(29,11-14-3-7-16(23)8-4-14)20(28)22(30,19(27)18(26)13-25)12-15-5-9-17(24)10-6-15/h2-10,18-20,25-30H,1,11-13H2/t18-,19+,20+,21?,22+/m0/s1 |
| InChIKey | CMGKMOPFCMROPO-PZOCDLFKSA-N |
| XLogP | 0.47 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|