About 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane
2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane (PubChem CID 141460639) has the molecular formula C14H30S
and a molecular weight of 230.46 g/mol. Its IUPAC name is 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane.
Molecular Properties
| Compound Name | 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane |
| PubChem CID | 141460639 |
| Molecular Formula | C14H30S |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane |
| SMILES | CC(C)C(C)C(C)SC(C)C(C)C(C)C |
| InChI | InChI=1S/C14H30S/c1-9(2)11(5)13(7)15-14(8)12(6)10(3)4/h9-14H,1-8H3 |
| InChIKey | WFZRGRDIEAMJNS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane?
The IUPAC name of 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane (CID 141460639) is 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane.
What is the SMILES notation for 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane?
The canonical SMILES for 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane is CC(C)C(C)C(C)SC(C)C(C)C(C)C.
What is the InChIKey of 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane?
The InChIKey is WFZRGRDIEAMJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30S/c1-9(2)11(5)13(7)15-14(8)12(6)10(3)4/h9-14H,1-8H3.
What are the key properties of 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane?
2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane has a molecular weight of 230.46 g/mol, XLogP of 5.08, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylpentan-2-ylsulfanyl)-3,4-dimethylpentane is sourced from PubChem (CID 141460639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).