About 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene
1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene (PubChem CID 141460970) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene |
| PubChem CID | 141460970 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene |
| SMILES | C=CC(N=C=O)c1cccc(C)c1C |
| InChI | InChI=1S/C12H13NO/c1-4-12(13-8-14)11-7-5-6-9(2)10(11)3/h4-7,12H,1H2,2-3H3 |
| InChIKey | SDLVMWCLAWNTSY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene?
The IUPAC name of 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene (CID 141460970) is 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene.
What is the SMILES notation for 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene?
The canonical SMILES for 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene is C=CC(N=C=O)c1cccc(C)c1C.
What is the InChIKey of 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene?
The InChIKey is SDLVMWCLAWNTSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-4-12(13-8-14)11-7-5-6-9(2)10(11)3/h4-7,12H,1H2,2-3H3.
What are the key properties of 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene?
1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene has a molecular weight of 187.24 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-isocyanatoprop-2-enyl)-2,3-dimethylbenzene is sourced from PubChem (CID 141460970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).