C14H11N3O5 — CID 141461953
7,7-dimethyl-2-(4-nitrophenyl)-3H-furo[3,4-d]pyrimidine-4,5-dione (PubChem CID 141461953) has the molecular formula C14H11N3O5 and a molecular weight of 301.26 g/mol. Its IUPAC name is 7,7-dimethyl-2-(4-nitrophenyl)-3H-furo[3,4-d]pyrimidine-4,5-dione.
| Compound Name | 7,7-dimethyl-2-(4-nitrophenyl)-3H-furo[3,4-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 141461953 |
| Molecular Formula | C14H11N3O5 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 7,7-dimethyl-2-(4-nitrophenyl)-3H-furo[3,4-d]pyrimidine-4,5-dione |
| SMILES | CC1(C)OC(=O)c2c1nc(-c1ccc([N+](=O)[O-])cc1)[nH]c2=O |
| InChI | InChI=1S/C14H11N3O5/c1-14(2)10-9(13(19)22-14)12(18)16-11(15-10)7-3-5-8(6-4-7)17(20)21/h3-6H,1-2H3,(H,15,16,18) |
| InChIKey | CEHOOCXNHCHGHQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|