C10H10N2O2 — CID 141461995
5-amino-1,2,7,8-tetrahydrofuro[3,2-e]isoindol-3-one (PubChem CID 141461995) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-amino-1,2,7,8-tetrahydrofuro[3,2-e]isoindol-3-one.
| Compound Name | 5-amino-1,2,7,8-tetrahydrofuro[3,2-e]isoindol-3-one |
|---|---|
| PubChem CID | 141461995 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 5-amino-1,2,7,8-tetrahydrofuro[3,2-e]isoindol-3-one |
| SMILES | Nc1cc2c(c3c1OCC3)CNC2=O |
| InChI | InChI=1S/C10H10N2O2/c11-8-3-6-7(4-12-10(6)13)5-1-2-14-9(5)8/h3H,1-2,4,11H2,(H,12,13) |
| InChIKey | OIKPTOQEEWPKBN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|