C21H16F2N2O3 — CID 141462220
(Z)-1-[3-(3,4-difluorophenyl)-1-[3-(hydroxymethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione (PubChem CID 141462220) has the molecular formula C21H16F2N2O3 and a molecular weight of 382.37 g/mol. Its IUPAC name is (Z)-1-[3-(3,4-difluorophenyl)-1-[3-(hydroxymethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione.
| Compound Name | (Z)-1-[3-(3,4-difluorophenyl)-1-[3-(hydroxymethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 141462220 |
| Molecular Formula | C21H16F2N2O3 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (Z)-1-[3-(3,4-difluorophenyl)-1-[3-(hydroxymethyl)phenyl]pyrazol-5-yl]pent-2-ene-1,4-dione |
| SMILES | CC(=O)/C=C\C(=O)c1cc(-c2ccc(F)c(F)c2)nn1-c1cccc(CO)c1 |
| InChI | InChI=1S/C21H16F2N2O3/c1-13(27)5-8-21(28)20-11-19(15-6-7-17(22)18(23)10-15)24-25(20)16-4-2-3-14(9-16)12-26/h2-11,26H,12H2,1H3/b8-5- |
| InChIKey | JPKCGGXGQHGERM-YVMONPNESA-N |
| XLogP | 3.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|