C28H28Cl2N6O3 — CID 141462277
N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1H-pyrazolo[5,4-b]pyridin-3-yl]-4-(4-prop-2-enylpiperazin-1-yl)benzamide (PubChem CID 141462277) has the molecular formula C28H28Cl2N6O3 and a molecular weight of 567.48 g/mol. Its IUPAC name is N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1H-pyrazolo[5,4-b]pyridin-3-yl]-4-(4-prop-2-enylpiperazin-1-yl)benzamide.
| Compound Name | N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1H-pyrazolo[5,4-b]pyridin-3-yl]-4-(4-prop-2-enylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 141462277 |
| Molecular Formula | C28H28Cl2N6O3 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | N-[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1H-pyrazolo[5,4-b]pyridin-3-yl]-4-(4-prop-2-enylpiperazin-1-yl)benzamide |
| SMILES | C=CCN1CCN(c2ccc(C(=O)Nc3n[nH]c4nc(-c5c(Cl)c(OC)cc(OC)c5Cl)ccc34)cc2)CC1 |
| InChI | InChI=1S/C28H28Cl2N6O3/c1-4-11-35-12-14-36(15-13-35)18-7-5-17(6-8-18)28(37)32-27-19-9-10-20(31-26(19)33-34-27)23-24(29)21(38-2)16-22(39-3)25(23)30/h4-10,16H,1,11-15H2,2-3H3,(H2,31,32,33,34,37) |
| InChIKey | CYOLKPKOHSHVTL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|