About [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate
[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate (PubChem CID 141463019) has the molecular formula C26H35FO4Si
and a molecular weight of 458.65 g/mol. Its IUPAC name is [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate.
Molecular Properties
| Compound Name | [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate |
| PubChem CID | 141463019 |
| Molecular Formula | C26H35FO4Si |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H]1C(C)(C)F |
| InChI | InChI=1S/C26H35FO4Si/c1-19(28)30-24-23(26(5,6)27)17-20(31-24)18-29-32(25(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24H,17-18H2,1-6H3/t20-,23+,24?/m0/s1 |
| InChIKey | PASACWTWEJCPQU-NKCAITPYSA-N |
| XLogP | 4.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate?
The IUPAC name of [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate (CID 141463019) is [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate.
What is the SMILES notation for [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate?
The canonical SMILES for [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate is CC(=O)OC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H]1C(C)(C)F.
What is the InChIKey of [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate?
The InChIKey is PASACWTWEJCPQU-NKCAITPYSA-N. The full InChI is InChI=1S/C26H35FO4Si/c1-19(28)30-24-23(26(5,6)27)17-20(31-24)18-29-32(25(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24H,17-18H2,1-6H3/t20-,23+,24?/m0/s1.
What are the key properties of [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate?
[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate has a molecular weight of 458.65 g/mol, XLogP of 4.61, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2-fluoropropan-2-yl)oxolan-2-yl] acetate is sourced from PubChem (CID 141463019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).