C30H33NO6S2 — CID 141463145
2-[2-[2-[[6-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2-pyridinyl]oxymethylidene]cyclohex-3-en-1-yl]thiophen-3-yl]acetic acid (PubChem CID 141463145) has the molecular formula C30H33NO6S2 and a molecular weight of 567.73 g/mol. Its IUPAC name is 2-[2-[2-[[6-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2-pyridinyl]oxymethylidene]cyclohex-3-en-1-yl]thiophen-3-yl]acetic acid.
| Compound Name | 2-[2-[2-[[6-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2-pyridinyl]oxymethylidene]cyclohex-3-en-1-yl]thiophen-3-yl]acetic acid |
|---|---|
| PubChem CID | 141463145 |
| Molecular Formula | C30H33NO6S2 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 2-[2-[2-[[6-[2,6-dimethyl-4-(3-methylsulfonylpropoxy)phenyl]-2-pyridinyl]oxymethylidene]cyclohex-3-en-1-yl]thiophen-3-yl]acetic acid |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)cc(C)c1-c1cccc(OC=C2C=CCCC2c2sccc2CC(=O)O)n1 |
| InChI | InChI=1S/C30H33NO6S2/c1-20-16-24(36-13-7-15-39(3,34)35)17-21(2)29(20)26-10-6-11-27(31-26)37-19-23-8-4-5-9-25(23)30-22(12-14-38-30)18-28(32)33/h4,6,8,10-12,14,16-17,19,25H,5,7,9,13,15,18H2,1-3H3,(H,32,33) |
| InChIKey | LKNYBRRYUCZEOP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|