2,3-difluoro-4-hydroxy-5-methylbenzoic acid

C8H6F2O3 — CID 141463270

IUPAC2,3-difluoro-4-hydroxy-5-methylbenzoic acid
SMILESCc1cc(C(=O)O)c(F)c(F)c1O
InChIInChI=1S/C8H6F2O3/c1-3-2-4(8(12)13)5(9)6(10)7(3)11/h2,11H,1H3,(H,12,13)
InChIKeyPYGYJQRAHXMUFH-UHFFFAOYSA-N
MW188.13 g/mol
LogP1.68
Rot. Bonds1

About 2,3-difluoro-4-hydroxy-5-methylbenzoic acid

2,3-difluoro-4-hydroxy-5-methylbenzoic acid (PubChem CID 141463270) has the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. Its IUPAC name is 2,3-difluoro-4-hydroxy-5-methylbenzoic acid.

Molecular Properties

Compound Name2,3-difluoro-4-hydroxy-5-methylbenzoic acid
PubChem CID141463270
Molecular FormulaC8H6F2O3
Molecular Weight188.13 g/mol
Exact Mass188.03
IUPAC Name2,3-difluoro-4-hydroxy-5-methylbenzoic acid
SMILESCc1cc(C(=O)O)c(F)c(F)c1O
InChIInChI=1S/C8H6F2O3/c1-3-2-4(8(12)13)5(9)6(10)7(3)11/h2,11H,1H3,(H,12,13)
InChIKeyPYGYJQRAHXMUFH-UHFFFAOYSA-N
XLogP1.68
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.13
LogP ≤ 51.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,3-difluoro-4-hydroxy-5-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-difluoro-4-hydroxy-5-methylbenzoic acid?
The IUPAC name of 2,3-difluoro-4-hydroxy-5-methylbenzoic acid (CID 141463270) is 2,3-difluoro-4-hydroxy-5-methylbenzoic acid.
What is the SMILES notation for 2,3-difluoro-4-hydroxy-5-methylbenzoic acid?
The canonical SMILES for 2,3-difluoro-4-hydroxy-5-methylbenzoic acid is Cc1cc(C(=O)O)c(F)c(F)c1O.
What is the InChIKey of 2,3-difluoro-4-hydroxy-5-methylbenzoic acid?
The InChIKey is PYGYJQRAHXMUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2O3/c1-3-2-4(8(12)13)5(9)6(10)7(3)11/h2,11H,1H3,(H,12,13).
What are the key properties of 2,3-difluoro-4-hydroxy-5-methylbenzoic acid?
2,3-difluoro-4-hydroxy-5-methylbenzoic acid has a molecular weight of 188.13 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-4-hydroxy-5-methylbenzoic acid is sourced from PubChem (CID 141463270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).