About 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride
2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride (PubChem CID 14146362) has the molecular formula C24H29ClN2O2
and a molecular weight of 412.96 g/mol. Its IUPAC name is 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride.
Molecular Properties
| Compound Name | 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride |
| PubChem CID | 14146362 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride |
| SMILES | C(=C/c1nc2ccccc2o1)\c1ccc(OCCCCN2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C24H28N2O2.ClH/c1-4-16-26(17-5-1)18-6-7-19-27-21-13-10-20(11-14-21)12-15-24-25-22-8-2-3-9-23(22)28-24;/h2-3,8-15H,1,4-7,16-19H2;1H/b15-12+; |
| InChIKey | KDOHTBUMBSBLHL-JRUHLWALSA-N |
| XLogP | 6.06 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride?
The IUPAC name of 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride (CID 14146362) is 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride.
What is the SMILES notation for 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride?
The canonical SMILES for 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride is C(=C/c1nc2ccccc2o1)\c1ccc(OCCCCN2CCCCC2)cc1.Cl.
What is the InChIKey of 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride?
The InChIKey is KDOHTBUMBSBLHL-JRUHLWALSA-N. The full InChI is InChI=1S/C24H28N2O2.ClH/c1-4-16-26(17-5-1)18-6-7-19-27-21-13-10-20(11-14-21)12-15-24-25-22-8-2-3-9-23(22)28-24;/h2-3,8-15H,1,4-7,16-19H2;1H/b15-12+;.
What are the key properties of 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride?
2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride has a molecular weight of 412.96 g/mol, XLogP of 6.06, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[4-(4-piperidin-1-ylbutoxy)phenyl]ethenyl]-1,3-benzoxazole;hydrochloride is sourced from PubChem (CID 14146362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).